אבקת Urolithin B

9 בנובמבר 2020

Cofttek היא יצרנית אבקת Urolithin B הטובה ביותר בסין. למפעל שלנו מערכת ניהול ייצור מלאה (ISO9001 & ISO14001), עם כושר ייצור חודשי של 200 ק"ג.

 


סטטוס: בהפקה המונית
יחידה: 1 ק"ג / שקית, 25 ק"ג / תוף

אורוליטין BSpecifications

שֵׁם: אורוליטין ב
שם כימי: 3-הידרוקסי-6 ח-דיבנזו [ב, ד] פיראן-6-און
CAS: 1139-83-9
נוסחה כימית: C13H8O3
משקל מולקולרי: X
צבע:  אבקה לבנה
מפתח InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
קוד SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
פונקציה: האורוליטין B יכול לשפר את תפקוד המיטוכונדריה והשרירים.

אורוליטין B יכול לשפר את כוח השרירים ואת הסיבולת במהלך ההזדקנות.

יישום: Urolithin B הוא מטבוליט מיקרוביאלי במעי של ellagitannis ומציג פעולות אנטי-אוקסידנטיות ופרו-אוקסידנטיות עוצמתיות, תלוי במערכת הניתוח ובתנאים. אורוליטין B יכול גם להציג פעילות אסטרוגנית ו / או אנטי אסטרוגנית.
מְסִיסוּת: מסיסים בקלות ב- N, N-dimethylformamide ו- dimethylmethylene. סולפון, מסיס מעט במתנול, אתנול ואתיל אצטט
זמני אחסון: Hygroscopic, -20 ° C מקפיא, תחת אווירה אינרטי
מצב משלוח: נשלחת תחת טמפרטורת הסביבה כמו כימיים מסוכנים. מוצר זה יציב מספיק במשך מספר שבועות במהלך המשלוח הרגיל והזמן המבוצע במכס.

 

אורוליטין ב ספקטרום NMR

אורוליתין B (1139-83-9) - ספקטרום NMR

 

אם אתה זקוק ל- COA, MSDS, HNMR עבור כל אצווה של מוצר ומידע אחר, אנא צרו קשר עם שלנו מנהל שיווק.

 

מבוא לאורוליטינים

אורוליתינים הם מטבוליטים משניים של חומצה אלגית שמקורם באלגיטנינים. בבני אדם אלגיטנינים מומרים על ידי המיקרופלורה במעיים לחומצה אלגית אשר הופכת עוד יותר לאורוליתינים A, אורוליתין B, אורוליתין C ואורוליתין D במעיים הגדולים.

Urolithin A (UA) הוא המטבוליט הנפוץ ביותר של אלגיטנינים. עם זאת, ידוע שאורוליתין A אינו מופיע באופן טבעי במקורות תזונתיים כלשהם.

Urolithin B (UB) הוא מטבוליט בשפע המיוצר במעיים באמצעות טרנספורמציה של אלגיטנינים. Urolithin B הוא המוצר האחרון לאחר שנגזרות האורוליתין האחרות עוברות קטבוליזם. Urolithin B נמצא בשתן כ- urolithin B glucuronide.

Urolithin A 8-Methyl Ether הוא מוצר הביניים במהלך הסינתזה של Urolithin A. זהו מטבוליט משני משמעותי של ellagitannin ובעל תכונות נוגדות חמצון ואנטי דלקתיות.

 

מנגנון פעולה של אורוליתין A ו- B.

● אורוליתין A גורם למיטופגיה

מיטופאגיה היא צורה אחת של אוטופאגיה המסייעת לחיסול המיטוכונדריה הפגועה לצורך תפקודם האופטימלי. אוטופאגיה מתייחסת לתהליך הכללי בו מתפרקים תכולת ציטופלסמה ובעקבות כך ממוחזרים בעוד שמיתופגיה היא השפלה ומחזור המיטוכונדריה.

במהלך ההזדקנות ירידה באוטופאגיה היא היבט אחד המוביל לירידה בתפקוד המיטוכונדריה. יתר על כן, מתח חמצוני יכול גם להוביל לאוטופגיה נמוכה. Urolithin A בעל יכולת לחסל את המיטוכונדריה הפגועה באמצעות אוטופגיה סלקטיבית.

● תכונות נוגדות חמצון

לחץ חמצוני מתרחש כאשר קיים חוסר איזון בין הרדיקלים החופשיים לנוגדי החמצון בגוף. רדיקלים חופשיים עודפים אלה קשורים לעיתים קרובות למחלות כרוניות רבות כגון הפרעות לב, סוכרת וסרטן.

האורוליטינים A ו- B מראים השפעות נוגדות חמצון באמצעות יכולתם להפחית את הרדיקלים החופשיים ובאופן ספציפי את רמת החמצן התגובתית התאי (ROS) וגם מעכבים את חמצן השומנים בסוגי תאים מסוימים.

יתר על כן, אורוליתינים מסוגלים לעכב כמה אנזימים מחמצנים, כולל מונואמין אוקסידאז A וטירוזינאז.

● תכונות אנטי דלקתיות

דלקת היא תהליך טבעי בו גופנו נלחם בכל דבר שנפל כמו זיהומים, פציעות וחיידקים. עם זאת, דלקת כרונית עלולה להזיק לגוף מכיוון שהדבר קשור להפרעות שונות כגון אסטמה, בעיות לב וסרטן. דלקת כרונית עלולה להתרחש עקב דלקת חריפה שלא טופלה, זיהומים או אפילו רדיקלים חופשיים בגוף.

האורוליתינים A ו- B מראים תכונות אנטי דלקתיות על ידי עיכוב ייצור תחמוצת החנקן. הם מעכבים באופן ספציפי חלבון iNOS (חלבון תחמוצת החנקן הניתנים להבעה) וביטוי mRNA האחראים לדלקת.

● השפעות אנטי מיקרוביאליות

חיידקים הכוללים חיידקים, פטריות ווירוסים מופיעים באופן טבעי בסביבה ואפילו בגוף האדם. עם זאת, כמה חיידקים המכונים פתוגנים עלולים לגרום למחלות זיהומיות כמו שפעת, חצבת ומלריה.

Urolithin A ו- B מסוגלים להפגין פעילות אנטי-מיקרוביאלית על ידי עיכוב חישת המניין. חישת קוורום היא מצב של תקשורת חיידקית המאפשרת לחיידקים לאתר ולשלוט בתהליכים הקשורים לזיהום כמו נגיפות ותנועתיות.

● עיכוב גליקציה של חלבונים

גליקציה מתייחסת לחיבור לא אנזימטי של סוכר לליפיד או חלבון. זהו סמן ביולוגי מרכזי בסוכרת והפרעות אחרות כמו גם הזדקנות.

גליקציה גבוהה של חלבון היא השפעה משנית של היפרגליקמיה יש תפקיד מרכזי בהפרעות הקשורות לב וכלי דם כמו סוכרת ומחלת אלצהיימר.

אורוליטין A ו- B הם בעלי תכונות אנטי-גליקטיביות התלויות במינון שאינן תלויות בפעילות הנוגד-חמצון שלהם.

 

יתרונות Urolithin B

לתוספי Urolithin B יש גם כמה יתרונות בריאותיים ורובם דומים ליתרונות urolithin A.

(1) פוטנציאל נגד סרטן
התכונות האנטי דלקתיות של האורוליטין B הופכות אותו למועמד טוב למלחמה בסרטן. ישנם חוקרים שדיווחו על פוטנציאל זה בסיביברובלסטים, מיקרופאגים ותאי אנדותל.

מחקרים דיווחו כי UB מעכב סוגים שונים של סרטן כמו סרטן הערמונית, המעי הגס ושלפוחית ​​השתן.

במחקר שכלל תאי סרטן המעי הגס אנושיים, נבדקו ellagitannins, חומצה אלגית ואורוליתינים A ו- B לגבי פוטנציאל האנטי סרטן שלהם. הם דיווחו כי כל הטיפולים הצליחו לעכב צמיחה של תאי הסרטן. הם עיכבו את התפשטות תאי הסרטן דרך מעצר מחזור תאים בשלבים שונים וגם על ידי גרימת אפופטוזיס.

(2) יכול לעזור במאבק נגד מתח חמצוני
לאורוליתין B יש תכונות נוגדות חמצון מצוינות באמצעות הפחתת רמות מינים של חמצן תגובתי וחמצון ליפידים בסוגי תאים מסוימים. הרמות הגבוהות של ROS קשורות להפרעות רבות כמו מחלת אלצהיימר.

במחקר עם תאים עצביים שנחשפו ללחץ חמצוני, נמצא כי תוסף אורוליטין B כמו גם אורוליטין A הגן על התאים מפני חמצון ומכאן הגבירו את הישרדות התא.

(3) Urolithin B לשיפור הזיכרון
דווח כי אורוליטין ב 'משפר את חדירות מחסום הדם. זה משפר את התפקוד הקוגניטיבי.

מחקרים מראים כי אורוליטין B יכול להוות משפר זיכרון פוטנציאלי על ידי שיפור התפקוד הקוגניטיבי הכללי.

(4) מונע אובדן שרירים
אובדן שרירים יכול להופיע בגלל סיבות שונות כמו הפרעות, הזדקנות ומחסור בחלבון בתזונה. ניתן להשתמש במספר אמצעים להפסקת, הגבלה או מניעה טובה יותר של אובדן שרירים, כולל פעילות גופנית, תרופות וחומצות אמינו, כמו גם פוליפנולים.

ניתן לסווג אורוליטינים כפוליפנולים ולמלא תפקיד במניעת אובדן שרירים על ידי הפעלת סינתזת חלבון שרירים וגם האטת השפלה.

במחקר שנערך עם עכברים, נמצא כי תוספי Urolithin B שננקטו לאורך תקופה משפרים את התפתחות השרירים שלהם ככל שנראו שרירים הולכים וגדלים.

(5) Urolithin B נלחם נגד דלקת
לאורוליטין B יש תכונות אנטי דלקתיות על ידי הפחתת מרבית סמני הדלקת.

במחקר שנערך על חולדות עם פיברוזיס כלייתי הנגרם, נמצא כי אורוליטין B משפר את הפגיעה בכליות. זה שיפר את תפקוד הכליות, את המורפולוגיה של הכליה וכן הפחית את סמני הפגיעה בכליות. זה מצביע על כך ש- UB הצליח להקל על דלקת הכליות.

(6) יתרונות סינרגטיים של אורוליטין A ו- B.
השפעות סינרגיסטיות דווחו גם בשילוב של אורוליטין A ו- B בתפקוד הקוגניטיבי וביכולתו. המחקר קבע כי ניתן להשתמש בשילוב זה לטיפול או מניעה של הפרעות הקשורות לדמנציה כגון חרדה או הפרעת אלצהיימר.

יתרונות נוספים הקשורים לאורוליטינים הם;

  • הגנה עצבית
  • Ameliorates תסמונת מטבולית

 

מקורות מזון Urolithin A ו- B

אורוליטינים לא ידועים כי הם נמצאים באופן טבעי בשום מקורות תזונתיים. הם תוצר של טרנספורמציה של חומצות אלגיות אשר נגזרות מאלגיטנינים. אלגיטנינים הופכים לחומצות אילגיות על ידי המיקרוביוטה של ​​המעי והחומצה האלגית ממירה למטבוליטים שלה (אורוליטינים) במעי הגס.

Ellagitannins מופיעים באופן טבעי במקורות מזון כגון רימונים, פירות יער כולל תותים, פטל, ענני ענבים אוכמניות, ענבי מוסקדין, שקדים, גויאבות, תה ואגוזים כגון אגוזי מלך וערמונים, כמו גם משקאות בגיל האלון, למשל יין אדום ויסקי מ חביות עץ אלון.

לכן אנו יכולים להסיק מזונות אורוליתין A ומזונות אורוליתין B הם מזון עשיר באלגיטנין. ראוי לציין כי הזמינות הביולוגית של ellagitannin מוגבלת מאוד בעוד שהמטבוליטים המשניים שלה (urolithins) זמינים בקלות.

הפרשת וייצור אורוליתינים משתנה מאוד בקרב אנשים מאחר שההמרה מאלגיטנינים מסתמכת על מיקרוביוטה במעיים. ישנם חיידקים ספציפיים המעורבים בהמרה אלה ומשתנים בין אנשים בהם יש מיקרוביוטה מתאימה גבוהה, נמוכה או לא זמינה. מקורות המזון משתנים גם ברמת האלגיטנינים שלהם. מכאן שהיתרונות הפוטנציאליים של אלגיטנינים משתנים מאדם לאדם.

 

תוספי אורוליתין A ו- B

תוספי אורוליתין A כמו גם תוספי אורוליתין B נמצאים בשוק כתוספי מקור מזון עשירים באלגיטנין. תוספי אורוליתין A זמינים גם כן. בעיקר תוספי הרימונים נמכרו בשימוש נרחב והשתמשו בהצלחה. תוספים אלה מסונתזים מהפירות או מהאגוזים ומנוסחים לצורת נוזלים או אבקה.

עקב שינויים בריכוז האלגיטנינים במזונות שונים, לקוחות אורוליתין קונים אותו בהתחשב במקור המזון. הדבר תקף גם למקורות אבקת אורוליתין B או תוספי תזונה נוזליים.

מעט המחקרים הקליניים בבני אדם שנערכו עם אבקת אורוליתין A או B לא דיווחו על תופעות לוואי חמורות ממתן תוספים אלה.

התייחסות

  1. גרסיה-מוניוז, כריסטינה; ויילאנט, פבריס (2014-12-02). "גורל מטבולי של Ellagitannins: השלכות על הבריאות ופרספקטיבות מחקר על מזונות פונקציונליים חדשניים". סקירות ביקורתיות במדעי המזון והתזונה.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 בנובמבר 2009). "אורוליתינים, מטבוליטים מיקרוביאליים של המעי של ellagitannins רימון, מפגינים פעילות נוגדת חמצון חזקה במבחן המבוסס על תאים". J מזון מזון חקלאי.
  3. בודוול, גרהם; פוטי, איאן; ננדלורו, פנצ'אל (2011). "סינתזה טוטאלית מבוססת דיאלים מבוססת אלגרים מבוססת אלדר של Urolithin M7".