Urolithin B (1139-83-9 factory מפעל היצרן

אורוליטין ב

9 בנובמבר 2020

אורוליטין BSpecifications

שֵׁם: אורוליטין ב
שם כימי: 3-הידרוקסי-6 ח-דיבנזו [ב, ד] פיראן-6-און
CAS: 1139-83-9
נוסחה כימית: C13H8O3
משקל מולקולרי: X
צבע:  אבקה לבנה
מפתח InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
קוד SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
פונקציה: האורוליטין B יכול לשפר את תפקוד המיטוכונדריה והשרירים.

אורוליטין B יכול לשפר את כוח השרירים ואת הסיבולת במהלך ההזדקנות.

יישום: Urolithin B הוא מטבוליט מיקרוביאלי במעי של ellagitannis ומציג פעולות אנטי-אוקסידנטיות ופרו-אוקסידנטיות עוצמתיות, תלוי במערכת הניתוח ובתנאים. אורוליטין B יכול גם להציג פעילות אסטרוגנית ו / או אנטי אסטרוגנית.
מְסִיסוּת: מסיסים בקלות ב- N, N-dimethylformamide ו- dimethylmethylene. סולפון, מסיס מעט במתנול, אתנול ואתיל אצטט
זמני אחסון: Hygroscopic, -20 ° C מקפיא, תחת אווירה אינרטי
מצב משלוח: נשלחת תחת טמפרטורת הסביבה כמו כימיים מסוכנים. מוצר זה יציב מספיק במשך מספר שבועות במהלך המשלוח הרגיל והזמן המבוצע במכס.